C17H15N5O5 — CID 23494864
N-(2,5-dimethoxyphenyl)-5-nitro-6-pyridin-3-yloxypyrimidin-4-amine (PubChem CID 23494864) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-5-nitro-6-pyridin-3-yloxypyrimidin-4-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-5-nitro-6-pyridin-3-yloxypyrimidin-4-amine |
|---|---|
| PubChem CID | 23494864 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-5-nitro-6-pyridin-3-yloxypyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2ncnc(Oc3cccnc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N5O5/c1-25-11-5-6-14(26-2)13(8-11)21-16-15(22(23)24)17(20-10-19-16)27-12-4-3-7-18-9-12/h3-10H,1-2H3,(H,19,20,21) |
| InChIKey | INYZRILMLLIAPL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|