C17H24N7O3+ — CID 7463613
4-N-(4-methylphenyl)-2-N-(2-morpholin-4-ium-4-ylethyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 7463613) has the molecular formula C17H24N7O3+ and a molecular weight of 374.43 g/mol. Its IUPAC name is 4-N-(4-methylphenyl)-2-N-(2-morpholin-4-ium-4-ylethyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(4-methylphenyl)-2-N-(2-morpholin-4-ium-4-ylethyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 7463613 |
| Molecular Formula | C17H24N7O3+ |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-N-(4-methylphenyl)-2-N-(2-morpholin-4-ium-4-ylethyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(NCC[NH+]3CCOCC3)nc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H23N7O3/c1-12-2-4-13(5-3-12)20-16-14(24(25)26)15(18)21-17(22-16)19-6-7-23-8-10-27-11-9-23/h2-5H,6-11H2,1H3,(H4,18,19,20,21,22)/p+1 |
| InChIKey | ZAEDLYCZVVWZRO-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 132.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|