C12H20N6O4 — CID 40517568
2-N-(2-methoxyethyl)-5-nitro-4-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine (PubChem CID 40517568) has the molecular formula C12H20N6O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-5-nitro-4-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(2-methoxyethyl)-5-nitro-4-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 40517568 |
| Molecular Formula | C12H20N6O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-N-(2-methoxyethyl)-5-nitro-4-N-[[(2R)-oxolan-2-yl]methyl]pyrimidine-2,4,6-triamine |
| SMILES | COCCNc1nc(N)c([N+](=O)[O-])c(NC[C@H]2CCCO2)n1 |
| InChI | InChI=1S/C12H20N6O4/c1-21-6-4-14-12-16-10(13)9(18(19)20)11(17-12)15-7-8-3-2-5-22-8/h8H,2-7H2,1H3,(H4,13,14,15,16,17)/t8-/m1/s1 |
| InChIKey | TWYAHTGWNWEVSV-MRVPVSSYSA-N |
| XLogP | 0.62 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|