C21H29N7O2 — CID 3974713
6-(4-benzylpiperazin-1-yl)-2-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 3974713) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-2-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-2-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 3974713 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-2-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CC1CCCN(c2nc(N)c([N+](=O)[O-])c(N3CCN(Cc4ccccc4)CC3)n2)C1 |
| InChI | InChI=1S/C21H29N7O2/c1-16-6-5-9-27(14-16)21-23-19(22)18(28(29)30)20(24-21)26-12-10-25(11-13-26)15-17-7-3-2-4-8-17/h2-4,7-8,16H,5-6,9-15H2,1H3,(H2,22,23,24) |
| InChIKey | WDNKTSCSAZDHDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|