C22H25N7O2 — CID 3918180
4-N-benzyl-2-(4-benzylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 3918180) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-N-benzyl-2-(4-benzylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-benzyl-2-(4-benzylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 3918180 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-N-benzyl-2-(4-benzylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Nc1nc(N2CCN(Cc3ccccc3)CC2)nc(NCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N7O2/c23-20-19(29(30)31)21(24-15-17-7-3-1-4-8-17)26-22(25-20)28-13-11-27(12-14-28)16-18-9-5-2-6-10-18/h1-10H,11-16H2,(H3,23,24,25,26) |
| InChIKey | HNTRQZZBIZSRRP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|