C21H29N7O3 — CID 7542737
6-(4-benzylpiperazin-1-yl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine (PubChem CID 7542737) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7542737 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine |
| SMILES | C[C@@H]1CN(c2nc(N)c([N+](=O)[O-])c(N3CCN(Cc4ccccc4)CC3)n2)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H29N7O3/c1-15-12-27(13-16(2)31-15)21-23-19(22)18(28(29)30)20(24-21)26-10-8-25(9-11-26)14-17-6-4-3-5-7-17/h3-7,15-16H,8-14H2,1-2H3,(H2,22,23,24)/t15-,16-/m1/s1 |
| InChIKey | AXSLYFJCYUFESI-HZPDHXFCSA-N |
| XLogP | 1.90 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|