C15H26N7O3+ — CID 7506221
2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 7506221) has the molecular formula C15H26N7O3+ and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7506221 |
| Molecular Formula | C15H26N7O3+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | C[C@H]1CN(c2nc(N)c([N+](=O)[O-])c(N3CC[NH+](C)CC3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H25N7O3/c1-10-8-21(9-11(2)25-10)15-17-13(16)12(22(23)24)14(18-15)20-6-4-19(3)5-7-20/h10-11H,4-9H2,1-3H3,(H2,16,17,18)/p+1/t10-,11-/m0/s1 |
| InChIKey | VSVLOVLJQPPIQS-QWRGUYRKSA-O |
| XLogP | -1.08 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|