C14H22N6O4 — CID 7562246
6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-morpholin-4-yl-5-nitropyrimidin-4-amine (PubChem CID 7562246) has the molecular formula C14H22N6O4 and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-morpholin-4-yl-5-nitropyrimidin-4-amine.
| Compound Name | 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-morpholin-4-yl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7562246 |
| Molecular Formula | C14H22N6O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-morpholin-4-yl-5-nitropyrimidin-4-amine |
| SMILES | C[C@H]1CN(c2nc(N3CCOCC3)nc(N)c2[N+](=O)[O-])C[C@H](C)O1 |
| InChI | InChI=1S/C14H22N6O4/c1-9-7-19(8-10(2)24-9)13-11(20(21)22)12(15)16-14(17-13)18-3-5-23-6-4-18/h9-10H,3-8H2,1-2H3,(H2,15,16,17)/t9-,10-/m0/s1 |
| InChIKey | CKTXPKSEMKDNNL-UWVGGRQHSA-N |
| XLogP | 0.42 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|