C20H30N8O2+2 — CID 7560047
6-(4-benzylpiperazin-4-ium-1-yl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 7560047) has the molecular formula C20H30N8O2+2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-4-ium-1-yl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperazin-4-ium-1-yl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7560047 |
| Molecular Formula | C20H30N8O2+2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 6-(4-benzylpiperazin-4-ium-1-yl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | C[NH+]1CCN(c2nc(N)c([N+](=O)[O-])c(N3CC[NH+](Cc4ccccc4)CC3)n2)CC1 |
| InChI | InChI=1S/C20H28N8O2/c1-24-7-11-27(12-8-24)20-22-18(21)17(28(29)30)19(23-20)26-13-9-25(10-14-26)15-16-5-3-2-4-6-16/h2-6H,7-15H2,1H3,(H2,21,22,23)/p+2 |
| InChIKey | CJKFHNLXAMYSAC-UHFFFAOYSA-P |
| XLogP | -1.79 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|