C9H15N6O2+ — CID 7067035
6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 7067035) has the molecular formula C9H15N6O2+ and a molecular weight of 239.26 g/mol. Its IUPAC name is 6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7067035 |
| Molecular Formula | C9H15N6O2+ |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 6-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | C[NH+]1CCN(c2ncnc(N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C9H14N6O2/c1-13-2-4-14(5-3-13)9-7(15(16)17)8(10)11-6-12-9/h6H,2-5H2,1H3,(H2,10,11,12)/p+1 |
| InChIKey | HEDYFGRLHPGNND-UHFFFAOYSA-O |
| XLogP | -1.70 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|