C10H14N6O3 — CID 102887830
4-(6-amino-5-nitropyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102887830) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-(6-amino-5-nitropyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(6-amino-5-nitropyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102887830 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-(6-amino-5-nitropyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2ncnc(N)c2[N+](=O)[O-])CC1=O |
| InChI | InChI=1S/C10H14N6O3/c1-14-3-2-4-15(5-7(14)17)10-8(16(18)19)9(11)12-6-13-10/h6H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | ZQPXCSWOFJQSJZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|