C10H15N5O3 — CID 80796375
6-(3,3-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-amine (PubChem CID 80796375) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 6-(3,3-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(3,3-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80796375 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6-(3,3-dimethylmorpholin-4-yl)-5-nitropyrimidin-4-amine |
| SMILES | CC1(C)COCCN1c1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N5O3/c1-10(2)5-18-4-3-14(10)9-7(15(16)17)8(11)12-6-13-9/h6H,3-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | FDERMGWORRSMLA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|