C15H19FN7O2+ — CID 7473940
4-N-(2-fluorophenyl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 7473940) has the molecular formula C15H19FN7O2+ and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-N-(2-fluorophenyl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-fluorophenyl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 7473940 |
| Molecular Formula | C15H19FN7O2+ |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-N-(2-fluorophenyl)-2-(4-methylpiperazin-4-ium-1-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | C[NH+]1CCN(c2nc(N)c([N+](=O)[O-])c(Nc3ccccc3F)n2)CC1 |
| InChI | InChI=1S/C15H18FN7O2/c1-21-6-8-22(9-7-21)15-19-13(17)12(23(24)25)14(20-15)18-11-5-3-2-4-10(11)16/h2-5H,6-9H2,1H3,(H3,17,18,19,20)/p+1 |
| InChIKey | RYVHHAUTHSKGOM-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|