C20H29N7O3 — CID 51699933
2-N-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine (PubChem CID 51699933) has the molecular formula C20H29N7O3 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-N-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 51699933 |
| Molecular Formula | C20H29N7O3 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-N-[(2S)-2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-5-nitro-6-piperidin-1-ylpyrimidine-2,4-diamine |
| SMILES | COc1ccccc1[C@@H](CNc1nc(N)c([N+](=O)[O-])c(N2CCCCC2)n1)N(C)C |
| InChI | InChI=1S/C20H29N7O3/c1-25(2)15(14-9-5-6-10-16(14)30-3)13-22-20-23-18(21)17(27(28)29)19(24-20)26-11-7-4-8-12-26/h5-6,9-10,15H,4,7-8,11-13H2,1-3H3,(H3,21,22,23,24)/t15-/m1/s1 |
| InChIKey | VEKJVHAQJYRCPK-OAHLLOKOSA-N |
| XLogP | 2.68 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|