C9H13N5O4S — CID 114045253
methyl 3-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)sulfanylpropanoate (PubChem CID 114045253) has the molecular formula C9H13N5O4S and a molecular weight of 287.30 g/mol. Its IUPAC name is methyl 3-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 114045253 |
| Molecular Formula | C9H13N5O4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | methyl 3-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)sulfanylpropanoate |
| SMILES | COC(=O)CCSc1nc(NN)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O4S/c1-5-7(14(16)17)8(12-9(11-5)13-10)19-4-3-6(15)18-2/h3-4,10H2,1-2H3,(H,11,12,13) |
| InChIKey | RZWMGXKUPDJWQO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|