C8H11ClN4O2S — CID 80922919
methyl 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylpropanoate (PubChem CID 80922919) has the molecular formula C8H11ClN4O2S and a molecular weight of 262.72 g/mol. Its IUPAC name is methyl 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 80922919 |
| Molecular Formula | C8H11ClN4O2S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | methyl 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylpropanoate |
| SMILES | COC(=O)CCSc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C8H11ClN4O2S/c1-15-6(14)2-3-16-7-5(9)4-11-8(12-7)13-10/h4H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | GXWPCNXRPWJORZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|