C6H9BrN4OS — CID 80921412
2-(5-bromo-2-hydrazinylpyrimidin-4-yl)sulfanylethanol (PubChem CID 80921412) has the molecular formula C6H9BrN4OS and a molecular weight of 265.14 g/mol. Its IUPAC name is 2-(5-bromo-2-hydrazinylpyrimidin-4-yl)sulfanylethanol.
| Compound Name | 2-(5-bromo-2-hydrazinylpyrimidin-4-yl)sulfanylethanol |
|---|---|
| PubChem CID | 80921412 |
| Molecular Formula | C6H9BrN4OS |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-(5-bromo-2-hydrazinylpyrimidin-4-yl)sulfanylethanol |
| SMILES | NNc1ncc(Br)c(SCCO)n1 |
| InChI | InChI=1S/C6H9BrN4OS/c7-4-3-9-6(11-8)10-5(4)13-2-1-12/h3,12H,1-2,8H2,(H,9,10,11) |
| InChIKey | BLMKFFSPYORMEH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|