C8H9BrN6S — CID 80922418
[5-bromo-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-yl]hydrazine (PubChem CID 80922418) has the molecular formula C8H9BrN6S and a molecular weight of 301.17 g/mol. Its IUPAC name is [5-bromo-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-yl]hydrazine.
| Compound Name | [5-bromo-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922418 |
| Molecular Formula | C8H9BrN6S |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | [5-bromo-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-yl]hydrazine |
| SMILES | Cn1ccnc1Sc1nc(NN)ncc1Br |
| InChI | InChI=1S/C8H9BrN6S/c1-15-3-2-11-8(15)16-6-5(9)4-12-7(13-6)14-10/h2-4H,10H2,1H3,(H,12,13,14) |
| InChIKey | GKZRETGQQXXLQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|