C7H11BrN4OS — CID 80922146
[5-bromo-4-(2-methoxyethylsulfanyl)pyrimidin-2-yl]hydrazine (PubChem CID 80922146) has the molecular formula C7H11BrN4OS and a molecular weight of 279.16 g/mol. Its IUPAC name is [5-bromo-4-(2-methoxyethylsulfanyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-bromo-4-(2-methoxyethylsulfanyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922146 |
| Molecular Formula | C7H11BrN4OS |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | [5-bromo-4-(2-methoxyethylsulfanyl)pyrimidin-2-yl]hydrazine |
| SMILES | COCCSc1nc(NN)ncc1Br |
| InChI | InChI=1S/C7H11BrN4OS/c1-13-2-3-14-6-5(8)4-10-7(11-6)12-9/h4H,2-3,9H2,1H3,(H,10,11,12) |
| InChIKey | RSBLDHJJPMEFDT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|