C8H13ClN4S — CID 80921912
(4-butylsulfanyl-5-chloropyrimidin-2-yl)hydrazine (PubChem CID 80921912) has the molecular formula C8H13ClN4S and a molecular weight of 232.74 g/mol. Its IUPAC name is (4-butylsulfanyl-5-chloropyrimidin-2-yl)hydrazine.
| Compound Name | (4-butylsulfanyl-5-chloropyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80921912 |
| Molecular Formula | C8H13ClN4S |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (4-butylsulfanyl-5-chloropyrimidin-2-yl)hydrazine |
| SMILES | CCCCSc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C8H13ClN4S/c1-2-3-4-14-7-6(9)5-11-8(12-7)13-10/h5H,2-4,10H2,1H3,(H,11,12,13) |
| InChIKey | BAVGFDXVUGVGEQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|