C10H16ClN3O2S2 — CID 80883328
5-chloro-4-(2-methylsulfonylethylsulfanyl)-N-propylpyrimidin-2-amine (PubChem CID 80883328) has the molecular formula C10H16ClN3O2S2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 5-chloro-4-(2-methylsulfonylethylsulfanyl)-N-propylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-(2-methylsulfonylethylsulfanyl)-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80883328 |
| Molecular Formula | C10H16ClN3O2S2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-chloro-4-(2-methylsulfonylethylsulfanyl)-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(Cl)c(SCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H16ClN3O2S2/c1-3-4-12-10-13-7-8(11)9(14-10)17-5-6-18(2,15)16/h7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | LFJNFZKELKQGRD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |