C13H13BrClN3S — CID 80888876
4-(3-bromophenyl)sulfanyl-5-chloro-N-propylpyrimidin-2-amine (PubChem CID 80888876) has the molecular formula C13H13BrClN3S and a molecular weight of 358.69 g/mol. Its IUPAC name is 4-(3-bromophenyl)sulfanyl-5-chloro-N-propylpyrimidin-2-amine.
| Compound Name | 4-(3-bromophenyl)sulfanyl-5-chloro-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80888876 |
| Molecular Formula | C13H13BrClN3S |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 4-(3-bromophenyl)sulfanyl-5-chloro-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(Cl)c(Sc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C13H13BrClN3S/c1-2-6-16-13-17-8-11(15)12(18-13)19-10-5-3-4-9(14)7-10/h3-5,7-8H,2,6H2,1H3,(H,16,17,18) |
| InChIKey | MBAHIRZUUNVILK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |