C11H10BrClN4S — CID 80889048
4-(3-bromophenyl)sulfanyl-6-chloro-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 80889048) has the molecular formula C11H10BrClN4S and a molecular weight of 345.65 g/mol. Its IUPAC name is 4-(3-bromophenyl)sulfanyl-6-chloro-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-bromophenyl)sulfanyl-6-chloro-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80889048 |
| Molecular Formula | C11H10BrClN4S |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 4-(3-bromophenyl)sulfanyl-6-chloro-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Cl)nc(Sc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C11H10BrClN4S/c1-2-14-10-15-9(13)16-11(17-10)18-8-5-3-4-7(12)6-8/h3-6H,2H2,1H3,(H,14,15,16,17) |
| InChIKey | AUEDARRYNXIPSY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |