C11H9Br2N3S — CID 80888784
5-bromo-4-(3-bromophenyl)sulfanyl-N-methylpyrimidin-2-amine (PubChem CID 80888784) has the molecular formula C11H9Br2N3S and a molecular weight of 375.09 g/mol. Its IUPAC name is 5-bromo-4-(3-bromophenyl)sulfanyl-N-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-(3-bromophenyl)sulfanyl-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80888784 |
| Molecular Formula | C11H9Br2N3S |
| Molecular Weight | 375.09 g/mol |
| Exact Mass | 372.89 |
| IUPAC Name | 5-bromo-4-(3-bromophenyl)sulfanyl-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(Br)c(Sc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C11H9Br2N3S/c1-14-11-15-6-9(13)10(16-11)17-8-4-2-3-7(12)5-8/h2-6H,1H3,(H,14,15,16) |
| InChIKey | OHBBSOWFTIFYQU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.09 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |