C11H8BrCl2N3S — CID 80891409
5-bromo-4-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-2-amine (PubChem CID 80891409) has the molecular formula C11H8BrCl2N3S and a molecular weight of 365.08 g/mol. Its IUPAC name is 5-bromo-4-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80891409 |
| Molecular Formula | C11H8BrCl2N3S |
| Molecular Weight | 365.08 g/mol |
| Exact Mass | 362.90 |
| IUPAC Name | 5-bromo-4-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(Br)c(Sc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H8BrCl2N3S/c1-15-11-16-5-7(12)10(17-11)18-6-2-3-8(13)9(14)4-6/h2-5H,1H3,(H,15,16,17) |
| InChIKey | ZFCUNDZEIQQJJH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.08 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |