C10H7BrCl2N4S — CID 80929377
[5-bromo-4-(3,4-dichlorophenyl)sulfanylpyrimidin-2-yl]hydrazine (PubChem CID 80929377) has the molecular formula C10H7BrCl2N4S and a molecular weight of 366.07 g/mol. Its IUPAC name is [5-bromo-4-(3,4-dichlorophenyl)sulfanylpyrimidin-2-yl]hydrazine.
| Compound Name | [5-bromo-4-(3,4-dichlorophenyl)sulfanylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80929377 |
| Molecular Formula | C10H7BrCl2N4S |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | [5-bromo-4-(3,4-dichlorophenyl)sulfanylpyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(Br)c(Sc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C10H7BrCl2N4S/c11-6-4-15-10(17-14)16-9(6)18-5-1-2-7(12)8(13)3-5/h1-4H,14H2,(H,15,16,17) |
| InChIKey | MVSRDWTZOKHQOM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|