C11H19N3S — CID 80884313
4-butylsulfanyl-N-ethyl-5-methylpyrimidin-2-amine (PubChem CID 80884313) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 4-butylsulfanyl-N-ethyl-5-methylpyrimidin-2-amine.
| Compound Name | 4-butylsulfanyl-N-ethyl-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80884313 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-butylsulfanyl-N-ethyl-5-methylpyrimidin-2-amine |
| SMILES | CCCCSc1nc(NCC)ncc1C |
| InChI | InChI=1S/C11H19N3S/c1-4-6-7-15-10-9(3)8-13-11(14-10)12-5-2/h8H,4-7H2,1-3H3,(H,12,13,14) |
| InChIKey | YGCKYCSRSRPMBZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|