C12H13N7S — CID 80892340
N-ethyl-5-methyl-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-amine (PubChem CID 80892340) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is N-ethyl-5-methyl-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-5-methyl-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80892340 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-ethyl-5-methyl-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-amine |
| SMILES | CCNc1ncc(C)c(Sc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C12H13N7S/c1-3-13-12-14-4-7(2)10(19-12)20-11-8-9(16-5-15-8)17-6-18-11/h4-6H,3H2,1-2H3,(H,13,14,19)(H,15,16,17,18) |
| InChIKey | LBKVRGZVLHEYQR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |