C11H12N6S2 — CID 79774146
N-ethyl-5-(7H-purin-6-ylsulfanylmethyl)-1,3-thiazol-2-amine (PubChem CID 79774146) has the molecular formula C11H12N6S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is N-ethyl-5-(7H-purin-6-ylsulfanylmethyl)-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-5-(7H-purin-6-ylsulfanylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774146 |
| Molecular Formula | C11H12N6S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-ethyl-5-(7H-purin-6-ylsulfanylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(CSc2ncnc3nc[nH]c23)s1 |
| InChI | InChI=1S/C11H12N6S2/c1-2-12-11-13-3-7(19-11)4-18-10-8-9(15-5-14-8)16-6-17-10/h3,5-6H,2,4H2,1H3,(H,12,13)(H,14,15,16,17) |
| InChIKey | GENJMDVHSHGYCN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |