C9H11N3S3 — CID 79774235
N-ethyl-5-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-amine (PubChem CID 79774235) has the molecular formula C9H11N3S3 and a molecular weight of 257.41 g/mol. Its IUPAC name is N-ethyl-5-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-5-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774235 |
| Molecular Formula | C9H11N3S3 |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-ethyl-5-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(CSc2nccs2)s1 |
| InChI | InChI=1S/C9H11N3S3/c1-2-10-8-12-5-7(15-8)6-14-9-11-3-4-13-9/h3-5H,2,6H2,1H3,(H,10,12) |
| InChIKey | RYXBOQCTULQSTP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|