C8H8N2S3 — CID 130670824
5-methyl-2-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazole (PubChem CID 130670824) has the molecular formula C8H8N2S3 and a molecular weight of 228.37 g/mol. Its IUPAC name is 5-methyl-2-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazole.
| Compound Name | 5-methyl-2-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130670824 |
| Molecular Formula | C8H8N2S3 |
| Molecular Weight | 228.37 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 5-methyl-2-(1,3-thiazol-2-ylsulfanylmethyl)-1,3-thiazole |
| SMILES | Cc1cnc(CSc2nccs2)s1 |
| InChI | InChI=1S/C8H8N2S3/c1-6-4-10-7(13-6)5-12-8-9-2-3-11-8/h2-4H,5H2,1H3 |
| InChIKey | BVCJIIMALCFNTO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|