C8H7NS3 — CID 130628845
2-(thiophen-2-ylmethylsulfanyl)-1,3-thiazole (PubChem CID 130628845) has the molecular formula C8H7NS3 and a molecular weight of 213.35 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethylsulfanyl)-1,3-thiazole.
| Compound Name | 2-(thiophen-2-ylmethylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130628845 |
| Molecular Formula | C8H7NS3 |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 2-(thiophen-2-ylmethylsulfanyl)-1,3-thiazole |
| SMILES | c1csc(CSc2nccs2)c1 |
| InChI | InChI=1S/C8H7NS3/c1-2-7(10-4-1)6-12-8-9-3-5-11-8/h1-5H,6H2 |
| InChIKey | JGNOFXDGBXTOCO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|