C11H11NOS3 — CID 97016350
2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-1,3-thiazole (PubChem CID 97016350) has the molecular formula C11H11NOS3 and a molecular weight of 269.42 g/mol. Its IUPAC name is 2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-1,3-thiazole.
| Compound Name | 2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97016350 |
| Molecular Formula | C11H11NOS3 |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 2-[2-[(S)-phenylsulfinyl]ethylsulfanyl]-1,3-thiazole |
| SMILES | O=[S@@](CCSc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C11H11NOS3/c13-16(10-4-2-1-3-5-10)9-8-15-11-12-6-7-14-11/h1-7H,8-9H2/t16-/m0/s1 |
| InChIKey | OWWZRAWMGUXWNR-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|