C13H16N2OS2 — CID 61220655
[2-[3-(1,3-thiazol-2-ylsulfanyl)propoxy]phenyl]methanamine (PubChem CID 61220655) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is [2-[3-(1,3-thiazol-2-ylsulfanyl)propoxy]phenyl]methanamine.
| Compound Name | [2-[3-(1,3-thiazol-2-ylsulfanyl)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 61220655 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [2-[3-(1,3-thiazol-2-ylsulfanyl)propoxy]phenyl]methanamine |
| SMILES | NCc1ccccc1OCCCSc1nccs1 |
| InChI | InChI=1S/C13H16N2OS2/c14-10-11-4-1-2-5-12(11)16-7-3-8-17-13-15-6-9-18-13/h1-2,4-6,9H,3,7-8,10,14H2 |
| InChIKey | BBKHJXWMINUMMU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|