C14H18N4OS2 — CID 111812274
1-(2-methoxyphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111812274) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 1-(2-methoxyphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111812274 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | COc1ccccc1N/C(N)=N/CCCSc1nccs1 |
| InChI | InChI=1S/C14H18N4OS2/c1-19-12-6-3-2-5-11(12)18-13(15)16-7-4-9-20-14-17-8-10-21-14/h2-3,5-6,8,10H,4,7,9H2,1H3,(H3,15,16,18) |
| InChIKey | HUGYVIVVZXCNGM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|