C15H20N4S2 — CID 111812284
1-(3,5-dimethylphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111812284) has the molecular formula C15H20N4S2 and a molecular weight of 320.49 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111812284 |
| Molecular Formula | C15H20N4S2 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCCSc2nccs2)c1 |
| InChI | InChI=1S/C15H20N4S2/c1-11-8-12(2)10-13(9-11)19-14(16)17-4-3-6-20-15-18-5-7-21-15/h5,7-10H,3-4,6H2,1-2H3,(H3,16,17,19) |
| InChIKey | GOQYVVYXEPOVCX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|