C10H19IN4OS2 — CID 111465987
1-(2-methoxyethyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide (PubChem CID 111465987) has the molecular formula C10H19IN4OS2 and a molecular weight of 402.33 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111465987 |
| Molecular Formula | C10H19IN4OS2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/CCCSc1nccs1.I |
| InChI | InChI=1S/C10H18N4OS2.HI/c1-15-6-4-13-9(11)12-3-2-7-16-10-14-5-8-17-10;/h5,8H,2-4,6-7H2,1H3,(H3,11,12,13);1H |
| InChIKey | OSDWCSZQZZZAMF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|