C14H26N4S2 — CID 111827461
1-ethyl-3-pentyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111827461) has the molecular formula C14H26N4S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-ethyl-3-pentyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 1-ethyl-3-pentyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111827461 |
| Molecular Formula | C14H26N4S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-ethyl-3-pentyl-2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | CCCCCN/C(=N/CCCSc1nccs1)NCC |
| InChI | InChI=1S/C14H26N4S2/c1-3-5-6-8-16-13(15-4-2)17-9-7-11-19-14-18-10-12-20-14/h10,12H,3-9,11H2,1-2H3,(H2,15,16,17) |
| InChIKey | OCCGQMUTKUGXBD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|