C14H21IN4S3 — CID 111829721
1-ethyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111829721) has the molecular formula C14H21IN4S3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 1-ethyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111829721 |
| Molecular Formula | C14H21IN4S3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 1-ethyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCCSc1nccs1.I |
| InChI | InChI=1S/C14H20N4S3.HI/c1-2-15-13(18-11-12-5-3-8-19-12)16-6-4-9-20-14-17-7-10-21-14;/h3,5,7-8,10H,2,4,6,9,11H2,1H3,(H2,15,16,18);1H |
| InChIKey | KZVXGRVKFFMGHJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|