C13H17N3OS2 — CID 60877518
[2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propoxy]phenyl]methanamine (PubChem CID 60877518) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is [2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propoxy]phenyl]methanamine.
| Compound Name | [2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 60877518 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propoxy]phenyl]methanamine |
| SMILES | Cc1nnc(SCCCOc2ccccc2CN)s1 |
| InChI | InChI=1S/C13H17N3OS2/c1-10-15-16-13(19-10)18-8-4-7-17-12-6-3-2-5-11(12)9-14/h2-3,5-6H,4,7-9,14H2,1H3 |
| InChIKey | VBCOJJHPCVYWEF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|