C9H11N5S2 — CID 62465954
[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-pyridinyl]hydrazine (PubChem CID 62465954) has the molecular formula C9H11N5S2 and a molecular weight of 253.36 g/mol. Its IUPAC name is [3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-pyridinyl]hydrazine.
| Compound Name | [3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62465954 |
| Molecular Formula | C9H11N5S2 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | [3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-pyridinyl]hydrazine |
| SMILES | Cc1nnc(SCc2cccnc2NN)s1 |
| InChI | InChI=1S/C9H11N5S2/c1-6-13-14-9(16-6)15-5-7-3-2-4-11-8(7)12-10/h2-4H,5,10H2,1H3,(H,11,12) |
| InChIKey | HBKUWYGICMXFBN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|