C13H15N3O2S2 — CID 63238329
[3-[(4-methylsulfonylphenyl)sulfanylmethyl]-2-pyridinyl]hydrazine (PubChem CID 63238329) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is [3-[(4-methylsulfonylphenyl)sulfanylmethyl]-2-pyridinyl]hydrazine.
| Compound Name | [3-[(4-methylsulfonylphenyl)sulfanylmethyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 63238329 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [3-[(4-methylsulfonylphenyl)sulfanylmethyl]-2-pyridinyl]hydrazine |
| SMILES | CS(=O)(=O)c1ccc(SCc2cccnc2NN)cc1 |
| InChI | InChI=1S/C13H15N3O2S2/c1-20(17,18)12-6-4-11(5-7-12)19-9-10-3-2-8-15-13(10)16-14/h2-8H,9,14H2,1H3,(H,15,16) |
| InChIKey | AHKRWYCVMZADRD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|