C12H11F2N3S — CID 62465416
[3-[(2,4-difluorophenyl)sulfanylmethyl]-2-pyridinyl]hydrazine (PubChem CID 62465416) has the molecular formula C12H11F2N3S and a molecular weight of 267.30 g/mol. Its IUPAC name is [3-[(2,4-difluorophenyl)sulfanylmethyl]-2-pyridinyl]hydrazine.
| Compound Name | [3-[(2,4-difluorophenyl)sulfanylmethyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62465416 |
| Molecular Formula | C12H11F2N3S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | [3-[(2,4-difluorophenyl)sulfanylmethyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ncccc1CSc1ccc(F)cc1F |
| InChI | InChI=1S/C12H11F2N3S/c13-9-3-4-11(10(14)6-9)18-7-8-2-1-5-16-12(8)17-15/h1-6H,7,15H2,(H,16,17) |
| InChIKey | WMGOJMTZOOJJPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|