C15H16F2N2S — CID 62468384
3-[(2,4-difluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine (PubChem CID 62468384) has the molecular formula C15H16F2N2S and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine.
| Compound Name | 3-[(2,4-difluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62468384 |
| Molecular Formula | C15H16F2N2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ncccc1CSc1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2N2S/c1-2-7-18-15-11(4-3-8-19-15)10-20-14-6-5-12(16)9-13(14)17/h3-6,8-9H,2,7,10H2,1H3,(H,18,19) |
| InChIKey | CULFSDUCIYIEOZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |