C11H15F2NS — CID 61385821
N-[2-(2,4-difluorophenyl)sulfanylethyl]propan-1-amine (PubChem CID 61385821) has the molecular formula C11H15F2NS and a molecular weight of 231.31 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)sulfanylethyl]propan-1-amine.
| Compound Name | N-[2-(2,4-difluorophenyl)sulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 61385821 |
| Molecular Formula | C11H15F2NS |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)sulfanylethyl]propan-1-amine |
| SMILES | CCCNCCSc1ccc(F)cc1F |
| InChI | InChI=1S/C11H15F2NS/c1-2-5-14-6-7-15-11-4-3-9(12)8-10(11)13/h3-4,8,14H,2,5-7H2,1H3 |
| InChIKey | OAJCQDNJIXPWEQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|