C13H20FNOS — CID 66128560
3-[4-fluoro-2-(propylaminomethyl)phenyl]sulfanylpropan-1-ol (PubChem CID 66128560) has the molecular formula C13H20FNOS and a molecular weight of 257.37 g/mol. Its IUPAC name is 3-[4-fluoro-2-(propylaminomethyl)phenyl]sulfanylpropan-1-ol.
| Compound Name | 3-[4-fluoro-2-(propylaminomethyl)phenyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 66128560 |
| Molecular Formula | C13H20FNOS |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[4-fluoro-2-(propylaminomethyl)phenyl]sulfanylpropan-1-ol |
| SMILES | CCCNCc1cc(F)ccc1SCCCO |
| InChI | InChI=1S/C13H20FNOS/c1-2-6-15-10-11-9-12(14)4-5-13(11)17-8-3-7-16/h4-5,9,15-16H,2-3,6-8,10H2,1H3 |
| InChIKey | TTYHVORDVBVCBL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|