C15H22FNOS — CID 63814240
N-[[5-fluoro-2-(oxan-4-ylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 63814240) has the molecular formula C15H22FNOS and a molecular weight of 283.41 g/mol. Its IUPAC name is N-[[5-fluoro-2-(oxan-4-ylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[5-fluoro-2-(oxan-4-ylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63814240 |
| Molecular Formula | C15H22FNOS |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[[5-fluoro-2-(oxan-4-ylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)ccc1SC1CCOCC1 |
| InChI | InChI=1S/C15H22FNOS/c1-2-7-17-11-12-10-13(16)3-4-15(12)19-14-5-8-18-9-6-14/h3-4,10,14,17H,2,5-9,11H2,1H3 |
| InChIKey | LLOQRCXHPKZKSR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|