C16H24FNS — CID 55240804
N-[[2-(cyclopentylmethylsulfanyl)-5-fluorophenyl]methyl]propan-1-amine (PubChem CID 55240804) has the molecular formula C16H24FNS and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[[2-(cyclopentylmethylsulfanyl)-5-fluorophenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(cyclopentylmethylsulfanyl)-5-fluorophenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 55240804 |
| Molecular Formula | C16H24FNS |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[[2-(cyclopentylmethylsulfanyl)-5-fluorophenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)ccc1SCC1CCCC1 |
| InChI | InChI=1S/C16H24FNS/c1-2-9-18-11-14-10-15(17)7-8-16(14)19-12-13-5-3-4-6-13/h7-8,10,13,18H,2-6,9,11-12H2,1H3 |
| InChIKey | KZSYAFFPQJFWCS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|