C16H20N2S — CID 62468389
3-[(2-methylphenyl)sulfanylmethyl]-N-propylpyridin-2-amine (PubChem CID 62468389) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 3-[(2-methylphenyl)sulfanylmethyl]-N-propylpyridin-2-amine.
| Compound Name | 3-[(2-methylphenyl)sulfanylmethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62468389 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[(2-methylphenyl)sulfanylmethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ncccc1CSc1ccccc1C |
| InChI | InChI=1S/C16H20N2S/c1-3-10-17-16-14(8-6-11-18-16)12-19-15-9-5-4-7-13(15)2/h4-9,11H,3,10,12H2,1-2H3,(H,17,18) |
| InChIKey | LOODZICFZFFVEK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |