C12H10F2N2S — CID 62468556
3-[(2,4-difluorophenyl)sulfanylmethyl]pyridin-2-amine (PubChem CID 62468556) has the molecular formula C12H10F2N2S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)sulfanylmethyl]pyridin-2-amine.
| Compound Name | 3-[(2,4-difluorophenyl)sulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62468556 |
| Molecular Formula | C12H10F2N2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-[(2,4-difluorophenyl)sulfanylmethyl]pyridin-2-amine |
| SMILES | Nc1ncccc1CSc1ccc(F)cc1F |
| InChI | InChI=1S/C12H10F2N2S/c13-9-3-4-11(10(14)6-9)17-7-8-2-1-5-16-12(8)15/h1-6H,7H2,(H2,15,16) |
| InChIKey | MHIQBJBSPFUBDM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |